C14H20Cl2N4O2 — CID 119879391
N-[6-(cyclopropanecarbonylamino)-3-pyridinyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119879391) has the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.25 g/mol. Its IUPAC name is N-[6-(cyclopropanecarbonylamino)-3-pyridinyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[6-(cyclopropanecarbonylamino)-3-pyridinyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119879391 |
| Molecular Formula | C14H20Cl2N4O2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[6-(cyclopropanecarbonylamino)-3-pyridinyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(NC(=O)C2CCCN2)cn1)C1CC1 |
| InChI | InChI=1S/C14H18N4O2.2ClH/c19-13(9-3-4-9)18-12-6-5-10(8-16-12)17-14(20)11-2-1-7-15-11;;/h5-6,8-9,11,15H,1-4,7H2,(H,17,20)(H,16,18,19);2*1H |
| InChIKey | PGYHORLDBGUOPQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |