C16H19ClN4O — CID 122081463
(2S)-N-(6-anilino-3-pyridinyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 122081463) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is (2S)-N-(6-anilino-3-pyridinyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-(6-anilino-3-pyridinyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122081463 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2S)-N-(6-anilino-3-pyridinyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(Nc2ccccc2)nc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H18N4O.ClH/c21-16(14-7-4-10-17-14)20-13-8-9-15(18-11-13)19-12-5-2-1-3-6-12;/h1-3,5-6,8-9,11,14,17H,4,7,10H2,(H,18,19)(H,20,21);1H/t14-;/m0./s1 |
| InChIKey | WBMYQXSWHMDFNX-UQKRIMTDSA-N |
| XLogP | 2.94 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |