C15H19Cl2N3O — CID 119840907
(2S)-N-quinolin-3-ylpiperidine-2-carboxamide;dihydrochloride (PubChem CID 119840907) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is (2S)-N-quinolin-3-ylpiperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-quinolin-3-ylpiperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119840907 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2S)-N-quinolin-3-ylpiperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cnc2ccccc2c1)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C15H17N3O.2ClH/c19-15(14-7-3-4-8-16-14)18-12-9-11-5-1-2-6-13(11)17-10-12;;/h1-2,5-6,9-10,14,16H,3-4,7-8H2,(H,18,19);2*1H/t14-;;/m0../s1 |
| InChIKey | WVMOYBVCHAQXCI-UTLKBRERSA-N |
| XLogP | 3.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |