C30H36N6O4 — CID 21341472
(2S,4S)-4-amino-4-[[(2R)-2-hydroxy-4-phenylbutanoyl]amino]-1-(piperidine-2-carbonyl)-N-quinolin-3-ylpyrrolidine-2-carboxamide (PubChem CID 21341472) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is (2S,4S)-4-amino-4-[[(2R)-2-hydroxy-4-phenylbutanoyl]amino]-1-(piperidine-2-carbonyl)-N-quinolin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-4-[[(2R)-2-hydroxy-4-phenylbutanoyl]amino]-1-(piperidine-2-carbonyl)-N-quinolin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21341472 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (2S,4S)-4-amino-4-[[(2R)-2-hydroxy-4-phenylbutanoyl]amino]-1-(piperidine-2-carbonyl)-N-quinolin-3-ylpyrrolidine-2-carboxamide |
| SMILES | N[C@]1(NC(=O)[C@H](O)CCc2ccccc2)C[C@@H](C(=O)Nc2cnc3ccccc3c2)N(C(=O)C2CCCCN2)C1 |
| InChI | InChI=1S/C30H36N6O4/c31-30(35-28(39)26(37)14-13-20-8-2-1-3-9-20)17-25(36(19-30)29(40)24-12-6-7-15-32-24)27(38)34-22-16-21-10-4-5-11-23(21)33-18-22/h1-5,8-11,16,18,24-26,32,37H,6-7,12-15,17,19,31H2,(H,34,38)(H,35,39)/t24?,25-,26+,30-/m0/s1 |
| InChIKey | IWBAOJDSSOXOGC-MBOWVNTMSA-N |
| XLogP | 1.68 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|