C15H18N4O — CID 59895156
(2S,4R)-4-amino-1-methyl-N-quinolin-3-ylpyrrolidine-2-carboxamide (PubChem CID 59895156) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is (2S,4R)-4-amino-1-methyl-N-quinolin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-1-methyl-N-quinolin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59895156 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2S,4R)-4-amino-1-methyl-N-quinolin-3-ylpyrrolidine-2-carboxamide |
| SMILES | CN1C[C@H](N)C[C@H]1C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H18N4O/c1-19-9-11(16)7-14(19)15(20)18-12-6-10-4-2-3-5-13(10)17-8-12/h2-6,8,11,14H,7,9,16H2,1H3,(H,18,20)/t11-,14+/m1/s1 |
| InChIKey | UOVOLXJVMKGJNE-RISCZKNCSA-N |
| XLogP | 1.20 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |