About methyl N-quinolin-3-ylcarbamate
methyl N-quinolin-3-ylcarbamate (PubChem CID 19697860) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl N-quinolin-3-ylcarbamate.
Molecular Properties
| Compound Name | methyl N-quinolin-3-ylcarbamate |
| PubChem CID | 19697860 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | methyl N-quinolin-3-ylcarbamate |
| SMILES | COC(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C11H10N2O2/c1-15-11(14)13-9-6-8-4-2-3-5-10(8)12-7-9/h2-7H,1H3,(H,13,14) |
| InChIKey | KZYHCHSHTVEJFR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-quinolin-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-quinolin-3-ylcarbamate?
The IUPAC name of methyl N-quinolin-3-ylcarbamate (CID 19697860) is methyl N-quinolin-3-ylcarbamate.
What is the SMILES notation for methyl N-quinolin-3-ylcarbamate?
The canonical SMILES for methyl N-quinolin-3-ylcarbamate is COC(=O)Nc1cnc2ccccc2c1.
What is the InChIKey of methyl N-quinolin-3-ylcarbamate?
The InChIKey is KZYHCHSHTVEJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-15-11(14)13-9-6-8-4-2-3-5-10(8)12-7-9/h2-7H,1H3,(H,13,14).
What are the key properties of methyl N-quinolin-3-ylcarbamate?
methyl N-quinolin-3-ylcarbamate has a molecular weight of 202.21 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-quinolin-3-ylcarbamate is sourced from PubChem (CID 19697860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).