C13H13N3O — CID 114995607
2-amino-N-quinolin-3-ylcyclopropane-1-carboxamide (PubChem CID 114995607) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-amino-N-quinolin-3-ylcyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-quinolin-3-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114995607 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-amino-N-quinolin-3-ylcyclopropane-1-carboxamide |
| SMILES | NC1CC1C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H13N3O/c14-11-6-10(11)13(17)16-9-5-8-3-1-2-4-12(8)15-7-9/h1-5,7,10-11H,6,14H2,(H,16,17) |
| InChIKey | JAGPRLALGYJUEP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |