C14H17Cl2N3O — CID 119840923
N-quinolin-3-ylpyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119840923) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is N-quinolin-3-ylpyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-quinolin-3-ylpyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119840923 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-quinolin-3-ylpyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cnc2ccccc2c1)C1CCNC1 |
| InChI | InChI=1S/C14H15N3O.2ClH/c18-14(11-5-6-15-8-11)17-12-7-10-3-1-2-4-13(10)16-9-12;;/h1-4,7,9,11,15H,5-6,8H2,(H,17,18);2*1H |
| InChIKey | NESUZRHGTBBSDE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |