C18H15N2O3- — CID 7470349
(1R,2R,3S,4S)-3-(quinolin-3-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 7470349) has the molecular formula C18H15N2O3- and a molecular weight of 307.33 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-(quinolin-3-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3S,4S)-3-(quinolin-3-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 7470349 |
| Molecular Formula | C18H15N2O3- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (1R,2R,3S,4S)-3-(quinolin-3-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1cnc2ccccc2c1)[C@@H]1[C@H](C(=O)[O-])[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H16N2O3/c21-17(15-11-5-6-12(7-11)16(15)18(22)23)20-13-8-10-3-1-2-4-14(10)19-9-13/h1-6,8-9,11-12,15-16H,7H2,(H,20,21)(H,22,23)/p-1/t11-,12+,15+,16-/m1/s1 |
| InChIKey | HMUPTDWCHFCLRC-GUYJKWIASA-M |
| XLogP | 1.36 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|