C13H20N4O — CID 104912943
(2R)-N-[6-(dimethylamino)-3-pyridinyl]piperidine-2-carboxamide (PubChem CID 104912943) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is (2R)-N-[6-(dimethylamino)-3-pyridinyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[6-(dimethylamino)-3-pyridinyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 104912943 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2R)-N-[6-(dimethylamino)-3-pyridinyl]piperidine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)[C@H]2CCCCN2)cn1 |
| InChI | InChI=1S/C13H20N4O/c1-17(2)12-7-6-10(9-15-12)16-13(18)11-5-3-4-8-14-11/h6-7,9,11,14H,3-5,8H2,1-2H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | IHFSWOWZJAKJSS-LLVKDONJSA-N |
| XLogP | 1.23 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |