C16H16FN3O2 — CID 119849104
N-[6-(4-fluorophenoxy)-3-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 119849104) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119849104 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)nc1)C1CCCN1 |
| InChI | InChI=1S/C16H16FN3O2/c17-11-3-6-13(7-4-11)22-15-8-5-12(10-19-15)20-16(21)14-2-1-9-18-14/h3-8,10,14,18H,1-2,9H2,(H,20,21) |
| InChIKey | AWEYLUHOFGBJGF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |