C17H20Cl2FN3O2 — CID 119849089
1-amino-N-[6-(4-fluorophenoxy)-3-pyridinyl]cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119849089) has the molecular formula C17H20Cl2FN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 1-amino-N-[6-(4-fluorophenoxy)-3-pyridinyl]cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-[6-(4-fluorophenoxy)-3-pyridinyl]cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119849089 |
| Molecular Formula | C17H20Cl2FN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-amino-N-[6-(4-fluorophenoxy)-3-pyridinyl]cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)Nc2ccc(Oc3ccc(F)cc3)nc2)CCCC1 |
| InChI | InChI=1S/C17H18FN3O2.2ClH/c18-12-3-6-14(7-4-12)23-15-8-5-13(11-20-15)21-16(22)17(19)9-1-2-10-17;;/h3-8,11H,1-2,9-10,19H2,(H,21,22);2*1H |
| InChIKey | RWLAVVWLROQJSZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |