C14H16BrN3O — CID 140776836
N-(6-bromo-3-cyclopropyl-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 140776836) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is N-(6-bromo-3-cyclopropyl-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(6-bromo-3-cyclopropyl-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 140776836 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-(6-bromo-3-cyclopropyl-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(Nc1nc(Br)ccc1C1CC1)C1CC2CC2N1 |
| InChI | InChI=1S/C14H16BrN3O/c15-12-4-3-9(7-1-2-7)13(17-12)18-14(19)11-6-8-5-10(8)16-11/h3-4,7-8,10-11,16H,1-2,5-6H2,(H,17,18,19) |
| InChIKey | UWXKDNYWIWSBJY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|