C15H13BrN2O — CID 80565871
N-(3-bromophenyl)-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 80565871) has the molecular formula C15H13BrN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 80565871 |
| Molecular Formula | C15H13BrN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | N-(3-bromophenyl)-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CNc2ccccc21 |
| InChI | InChI=1S/C15H13BrN2O/c16-10-4-3-5-11(8-10)18-15(19)13-9-17-14-7-2-1-6-12(13)14/h1-8,13,17H,9H2,(H,18,19) |
| InChIKey | KLQAINPIIKAGQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |