C15H13BrN2O2 — CID 24694997
N-(3-bromophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 24694997) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(3-bromophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 24694997 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(3-bromophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C15H13BrN2O2/c16-10-4-3-5-11(8-10)18-15(19)14-9-17-12-6-1-2-7-13(12)20-14/h1-8,14,17H,9H2,(H,18,19) |
| InChIKey | ICJJORFKOSBSSE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |