C13H12N4O2 — CID 116786757
N-pyridazin-3-yl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 116786757) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-pyridazin-3-yl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-pyridazin-3-yl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 116786757 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-pyridazin-3-yl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(Nc1cccnn1)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C13H12N4O2/c18-13(16-12-6-3-7-15-17-12)11-8-14-9-4-1-2-5-10(9)19-11/h1-7,11,14H,8H2,(H,16,17,18) |
| InChIKey | WJXRDBKJXLHJJY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |