About methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate
methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate (PubChem CID 2090947) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate.
Analyze methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate?
The IUPAC name of methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate (CID 2090947) is methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate.
What is the SMILES notation for methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate?
The canonical SMILES for methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate is COC(=O)[C@H]1CNc2ccccc2O1.
What is the InChIKey of methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate?
The InChIKey is HKOFHRITCCBESJ-SECBINFHSA-N. The full InChI is InChI=1S/C10H11NO3/c1-13-10(12)9-6-11-7-4-2-3-5-8(7)14-9/h2-5,9,11H,6H2,1H3/t9-/m1/s1.
What are the key properties of methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate?
methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate has a molecular weight of 193.20 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate is sourced from PubChem (CID 2090947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).