C17H18N2O2 — CID 24690489
N-benzyl-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 24690489) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-benzyl-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-benzyl-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 24690489 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-benzyl-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C17H18N2O2/c1-19(12-13-7-3-2-4-8-13)17(20)16-11-18-14-9-5-6-10-15(14)21-16/h2-10,16,18H,11-12H2,1H3 |
| InChIKey | BNXPQJWYUWBFDV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |