C18H19NO2 — CID 116550220
1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)-4-phenylbutan-1-one (PubChem CID 116550220) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)-4-phenylbutan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 116550220 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C18H19NO2/c20-16(11-6-9-14-7-2-1-3-8-14)18-13-19-15-10-4-5-12-17(15)21-18/h1-5,7-8,10,12,18-19H,6,9,11,13H2 |
| InChIKey | BUGUXYBUCLKTSE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |