C14H18N2O3 — CID 83235668
N-cyclopentyloxy-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 83235668) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-cyclopentyloxy-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-cyclopentyloxy-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 83235668 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-cyclopentyloxy-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(NOC1CCCC1)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C14H18N2O3/c17-14(16-19-10-5-1-2-6-10)13-9-15-11-7-3-4-8-12(11)18-13/h3-4,7-8,10,13,15H,1-2,5-6,9H2,(H,16,17) |
| InChIKey | IRNWGIMKLLSGCG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|