C9H12N2O2S — CID 110906941
1-hydroxy-N-(1,3-thiazol-2-yl)cyclopentane-1-carboxamide (PubChem CID 110906941) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-hydroxy-N-(1,3-thiazol-2-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-hydroxy-N-(1,3-thiazol-2-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110906941 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-hydroxy-N-(1,3-thiazol-2-yl)cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1nccs1)C1(O)CCCC1 |
| InChI | InChI=1S/C9H12N2O2S/c12-7(9(13)3-1-2-4-9)11-8-10-5-6-14-8/h5-6,13H,1-4H2,(H,10,11,12) |
| InChIKey | NTCIKQFJOQPHGM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |