C10H15N3OS — CID 129369013
(3S)-3-methyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 129369013) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is (3S)-3-methyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-3-methyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129369013 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (3S)-3-methyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | C[C@]1(C(=O)Nc2nccs2)CCCNC1 |
| InChI | InChI=1S/C10H15N3OS/c1-10(3-2-4-11-7-10)8(14)13-9-12-5-6-15-9/h5-6,11H,2-4,7H2,1H3,(H,12,13,14)/t10-/m0/s1 |
| InChIKey | OQQFCFKXMNQBSW-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |