C5H8Cl2N4O2S — CID 174438670
1-methyl-1-nitroso-3-(1,3-thiazol-2-yl)urea;dihydrochloride (PubChem CID 174438670) has the molecular formula C5H8Cl2N4O2S and a molecular weight of 259.12 g/mol. Its IUPAC name is 1-methyl-1-nitroso-3-(1,3-thiazol-2-yl)urea;dihydrochloride.
| Compound Name | 1-methyl-1-nitroso-3-(1,3-thiazol-2-yl)urea;dihydrochloride |
|---|---|
| PubChem CID | 174438670 |
| Molecular Formula | C5H8Cl2N4O2S |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 1-methyl-1-nitroso-3-(1,3-thiazol-2-yl)urea;dihydrochloride |
| SMILES | CN(N=O)C(=O)Nc1nccs1.Cl.Cl |
| InChI | InChI=1S/C5H6N4O2S.2ClH/c1-9(8-11)5(10)7-4-6-2-3-12-4;;/h2-3H,1H3,(H,6,7,10);2*1H |
| InChIKey | GBJMLGJWVFQODT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|