C7H10N2O2S — CID 62638118
2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 62638118) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid.
| Compound Name | 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 62638118 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)c1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5(6(10)11)9(2)7-8-3-4-12-7/h3-5H,1-2H3,(H,10,11) |
| InChIKey | KWOSKSDBEHKQIW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |