2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid

C7H10N2O2S — CID 62638118

IUPAC2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid
SMILESCC(C(=O)O)N(C)c1nccs1
InChIInChI=1S/C7H10N2O2S/c1-5(6(10)11)9(2)7-8-3-4-12-7/h3-5H,1-2H3,(H,10,11)
InChIKeyKWOSKSDBEHKQIW-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.05
Rot. Bonds3

About 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid

2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 62638118) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid.

Molecular Properties

Compound Name2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid
PubChem CID62638118
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid
SMILESCC(C(=O)O)N(C)c1nccs1
InChIInChI=1S/C7H10N2O2S/c1-5(6(10)11)9(2)7-8-3-4-12-7/h3-5H,1-2H3,(H,10,11)
InChIKeyKWOSKSDBEHKQIW-UHFFFAOYSA-N
XLogP1.05
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The IUPAC name of 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid (CID 62638118) is 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid.
What is the SMILES notation for 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The canonical SMILES for 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid is CC(C(=O)O)N(C)c1nccs1.
What is the InChIKey of 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The InChIKey is KWOSKSDBEHKQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-5(6(10)11)9(2)7-8-3-4-12-7/h3-5H,1-2H3,(H,10,11).
What are the key properties of 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid has a molecular weight of 186.24 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid is sourced from PubChem (CID 62638118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).