C5H5ClN2OS — CID 119090287
N-methyl-N-(1,3-thiazol-2-yl)carbamoyl chloride (PubChem CID 119090287) has the molecular formula C5H5ClN2OS and a molecular weight of 176.63 g/mol. Its IUPAC name is N-methyl-N-(1,3-thiazol-2-yl)carbamoyl chloride.
| Compound Name | N-methyl-N-(1,3-thiazol-2-yl)carbamoyl chloride |
|---|---|
| PubChem CID | 119090287 |
| Molecular Formula | C5H5ClN2OS |
| Molecular Weight | 176.63 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | N-methyl-N-(1,3-thiazol-2-yl)carbamoyl chloride |
| SMILES | CN(C(=O)Cl)c1nccs1 |
| InChI | InChI=1S/C5H5ClN2OS/c1-8(4(6)9)5-7-2-3-10-5/h2-3H,1H3 |
| InChIKey | LUHFOHFNXJZUGY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|