C13H10ClN3OS — CID 86768422
6-chloro-N-methyl-N-(1,3-thiazol-2-yl)-1H-indole-2-carboxamide (PubChem CID 86768422) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-(1,3-thiazol-2-yl)-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-methyl-N-(1,3-thiazol-2-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 86768422 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 6-chloro-N-methyl-N-(1,3-thiazol-2-yl)-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2ccc(Cl)cc2[nH]1)c1nccs1 |
| InChI | InChI=1S/C13H10ClN3OS/c1-17(13-15-4-5-19-13)12(18)11-6-8-2-3-9(14)7-10(8)16-11/h2-7,16H,1H3 |
| InChIKey | WKNPMHILCNEXLF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |