C11H9ClN2OS — CID 110723358
3-chloro-N-methyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 110723358) has the molecular formula C11H9ClN2OS and a molecular weight of 252.73 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-chloro-N-methyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 110723358 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 3-chloro-N-methyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CN(C(=O)c1cccc(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C11H9ClN2OS/c1-14(11-13-5-6-16-11)10(15)8-3-2-4-9(12)7-8/h2-7H,1H3 |
| InChIKey | YMFOVBGNFMYTSV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |