C12H10ClNOS2 — CID 61220658
1-(3-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propan-1-one (PubChem CID 61220658) has the molecular formula C12H10ClNOS2 and a molecular weight of 283.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 61220658 |
| Molecular Formula | C12H10ClNOS2 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propan-1-one |
| SMILES | CC(Sc1nccs1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H10ClNOS2/c1-8(17-12-14-5-6-16-12)11(15)9-3-2-4-10(13)7-9/h2-8H,1H3 |
| InChIKey | RMUYQNAVHPQQOR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|