C12H15ClO2S — CID 66127885
1-(3-chlorophenyl)-2-(3-hydroxypropylsulfanyl)propan-1-one (PubChem CID 66127885) has the molecular formula C12H15ClO2S and a molecular weight of 258.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(3-hydroxypropylsulfanyl)propan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-(3-hydroxypropylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 66127885 |
| Molecular Formula | C12H15ClO2S |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(3-hydroxypropylsulfanyl)propan-1-one |
| SMILES | CC(SCCCO)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15ClO2S/c1-9(16-7-3-6-14)12(15)10-4-2-5-11(13)8-10/h2,4-5,8-9,14H,3,6-7H2,1H3 |
| InChIKey | LWLVFIFSZXBLNW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|