C12H10ClFN2OS2 — CID 47365076
N-(2-chloro-4-fluorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide (PubChem CID 47365076) has the molecular formula C12H10ClFN2OS2 and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 47365076 |
| Molecular Formula | C12H10ClFN2OS2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| SMILES | CC(Sc1nccs1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H10ClFN2OS2/c1-7(19-12-15-4-5-18-12)11(17)16-10-3-2-8(14)6-9(10)13/h2-7H,1H3,(H,16,17) |
| InChIKey | DETWUOPBUCCAKW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|