C20H18ClN3O3S2 — CID 55642713
4-chloro-N-methyl-3-[phenyl(prop-2-enyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 55642713) has the molecular formula C20H18ClN3O3S2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-chloro-N-methyl-3-[phenyl(prop-2-enyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-chloro-N-methyl-3-[phenyl(prop-2-enyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55642713 |
| Molecular Formula | C20H18ClN3O3S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 4-chloro-N-methyl-3-[phenyl(prop-2-enyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)N(C)c2nccs2)ccc1Cl |
| InChI | InChI=1S/C20H18ClN3O3S2/c1-3-12-24(16-7-5-4-6-8-16)29(26,27)18-14-15(9-10-17(18)21)19(25)23(2)20-22-11-13-28-20/h3-11,13-14H,1,12H2,2H3 |
| InChIKey | LBLVSDGOWBEWFW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|