C14H17ClN2O2 — CID 111695370
6-chloro-N-(3-hydroxybutyl)-N-methyl-1H-indole-2-carboxamide (PubChem CID 111695370) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 6-chloro-N-(3-hydroxybutyl)-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-(3-hydroxybutyl)-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 111695370 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-chloro-N-(3-hydroxybutyl)-N-methyl-1H-indole-2-carboxamide |
| SMILES | CC(O)CCN(C)C(=O)c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-9(18)5-6-17(2)14(19)13-7-10-3-4-11(15)8-12(10)16-13/h3-4,7-9,16,18H,5-6H2,1-2H3 |
| InChIKey | OFYDAONXZWLHEQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |