C14H18N2O — CID 47186797
N,N-dimethyl-6-propan-2-yl-1H-indole-2-carboxamide (PubChem CID 47186797) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N,N-dimethyl-6-propan-2-yl-1H-indole-2-carboxamide.
| Compound Name | N,N-dimethyl-6-propan-2-yl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47186797 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N,N-dimethyl-6-propan-2-yl-1H-indole-2-carboxamide |
| SMILES | CC(C)c1ccc2cc(C(=O)N(C)C)[nH]c2c1 |
| InChI | InChI=1S/C14H18N2O/c1-9(2)10-5-6-11-8-13(14(17)16(3)4)15-12(11)7-10/h5-9,15H,1-4H3 |
| InChIKey | JHKVGVXMJOFZGF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |