About N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide (PubChem CID 94021081) has the molecular formula C17H22N2O3S
and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide |
| PubChem CID | 94021081 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide |
| SMILES | CC(C)c1ccc2cc(C(=O)NC[C@H]3CCS(=O)(=O)C3)[nH]c2c1 |
| InChI | InChI=1S/C17H22N2O3S/c1-11(2)13-3-4-14-8-16(19-15(14)7-13)17(20)18-9-12-5-6-23(21,22)10-12/h3-4,7-8,11-12,19H,5-6,9-10H2,1-2H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | FVGZPKIITVPRHW-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide?
The IUPAC name of N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide (CID 94021081) is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide.
What is the SMILES notation for N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide?
The canonical SMILES for N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide is CC(C)c1ccc2cc(C(=O)NC[C@H]3CCS(=O)(=O)C3)[nH]c2c1.
What is the InChIKey of N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide?
The InChIKey is FVGZPKIITVPRHW-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H22N2O3S/c1-11(2)13-3-4-14-8-16(19-15(14)7-13)17(20)18-9-12-5-6-23(21,22)10-12/h3-4,7-8,11-12,19H,5-6,9-10H2,1-2H3,(H,18,20)/t12-/m1/s1.
What are the key properties of N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide?
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide has a molecular weight of 334.44 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-propan-2-yl-1H-indole-2-carboxamide is sourced from PubChem (CID 94021081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).