C15H18N2O3S — CID 94020775
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-methyl-1H-indole-2-carboxamide (PubChem CID 94020775) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 94020775 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-6-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NC[C@H]3CCS(=O)(=O)C3)[nH]c2c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-10-2-3-12-7-14(17-13(12)6-10)15(18)16-8-11-4-5-21(19,20)9-11/h2-3,6-7,11,17H,4-5,8-9H2,1H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | LYQKDJOKCDNAEE-LLVKDONJSA-N |
| XLogP | 1.64 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |