C14H15ClN2O3S — CID 94006807
5-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 94006807) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 5-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 94006807 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 5-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC[C@H]1CCS(=O)(=O)C1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C14H15ClN2O3S/c15-11-1-2-12-10(5-11)6-13(17-12)14(18)16-7-9-3-4-21(19,20)8-9/h1-2,5-6,9,17H,3-4,7-8H2,(H,16,18)/t9-/m1/s1 |
| InChIKey | PTBYIOUXPQXDMF-SECBINFHSA-N |
| XLogP | 1.99 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |