C12H11ClN2O — CID 53016250
5-chloro-N-cyclopropyl-1H-indole-2-carboxamide (PubChem CID 53016250) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-cyclopropyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 53016250 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-chloro-N-cyclopropyl-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CC1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C12H11ClN2O/c13-8-1-4-10-7(5-8)6-11(15-10)12(16)14-9-2-3-9/h1,4-6,9,15H,2-3H2,(H,14,16) |
| InChIKey | AFWRHDIETZNAEG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |