C15H16ClN3O — CID 18442852
N-[(1R,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-1H-indole-2-carboxamide (PubChem CID 18442852) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is N-[(1R,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 18442852 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(1R,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-1H-indole-2-carboxamide |
| SMILES | N[C@H]1CC=CC[C@H]1NC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C15H16ClN3O/c16-10-5-6-12-9(7-10)8-14(18-12)15(20)19-13-4-2-1-3-11(13)17/h1-2,5-8,11,13,18H,3-4,17H2,(H,19,20)/t11-,13+/m0/s1 |
| InChIKey | GQKKQUOGDYGLPX-WCQYABFASA-N |
| XLogP | 2.60 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|