C18H22ClN3O3 — CID 68905442
N-[(3aS,5R,6S,7aR)-6-amino-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-5-chloro-1H-indole-2-carboxamide (PubChem CID 68905442) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is N-[(3aS,5R,6S,7aR)-6-amino-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[(3aS,5R,6S,7aR)-6-amino-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 68905442 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[(3aS,5R,6S,7aR)-6-amino-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-5-chloro-1H-indole-2-carboxamide |
| SMILES | CC1(C)O[C@H]2C[C@@H](NC(=O)c3cc4cc(Cl)ccc4[nH]3)[C@@H](N)C[C@H]2O1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-18(2)24-15-7-11(20)13(8-16(15)25-18)22-17(23)14-6-9-5-10(19)3-4-12(9)21-14/h3-6,11,13,15-16,21H,7-8,20H2,1-2H3,(H,22,23)/t11-,13+,15+,16-/m0/s1 |
| InChIKey | UCOCWKZIZJONBO-ZCDTZLGTSA-N |
| XLogP | 2.56 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |