C19H25ClN4O3 — CID 68602421
tert-butyl (4S)-3-amino-4-[(5-chloro-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 68602421) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is tert-butyl (4S)-3-amino-4-[(5-chloro-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-amino-4-[(5-chloro-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68602421 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | tert-butyl (4S)-3-amino-4-[(5-chloro-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](NC(=O)c2cc3cc(Cl)ccc3[nH]2)C(N)C1 |
| InChI | InChI=1S/C19H25ClN4O3/c1-19(2,3)27-18(26)24-7-6-15(13(21)10-24)23-17(25)16-9-11-8-12(20)4-5-14(11)22-16/h4-5,8-9,13,15,22H,6-7,10,21H2,1-3H3,(H,23,25)/t13?,15-/m0/s1 |
| InChIKey | QWVZNLCVWGHPNW-WUJWULDRSA-N |
| XLogP | 2.89 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |