C20H26ClN3O3 — CID 66785253
tert-butyl 1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 66785253) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is tert-butyl 1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66785253 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl 1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N)CCCCC1NC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-19(2,3)27-18(26)20(22)9-5-4-6-16(20)24-17(25)15-11-12-10-13(21)7-8-14(12)23-15/h7-8,10-11,16,23H,4-6,9,22H2,1-3H3,(H,24,25) |
| InChIKey | AHGRZZDJPCEAPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |