C28H35ClN4O4 — CID 66786135
tert-butyl 4-[3-[1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-3-oxoprop-1-ynyl]piperidine-1-carboxylate (PubChem CID 66786135) has the molecular formula C28H35ClN4O4 and a molecular weight of 527.07 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-3-oxoprop-1-ynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-3-oxoprop-1-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66786135 |
| Molecular Formula | C28H35ClN4O4 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | tert-butyl 4-[3-[1-amino-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-3-oxoprop-1-ynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#CC(=O)C2(N)CCCCC2NC(=O)c2cc3cc(Cl)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C28H35ClN4O4/c1-27(2,3)37-26(36)33-14-11-18(12-15-33)7-10-24(34)28(30)13-5-4-6-23(28)32-25(35)22-17-19-16-20(29)8-9-21(19)31-22/h8-9,16-18,23,31H,4-6,11-15,30H2,1-3H3,(H,32,35) |
| InChIKey | OAWKMQLZQUWYTA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|