C21H25ClN6O3 — CID 158732328
tert-butyl 3-[[(5-chloro-1H-indole-2-carbonyl)amino]methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 158732328) has the molecular formula C21H25ClN6O3 and a molecular weight of 444.92 g/mol. Its IUPAC name is tert-butyl 3-[[(5-chloro-1H-indole-2-carbonyl)amino]methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | tert-butyl 3-[[(5-chloro-1H-indole-2-carbonyl)amino]methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 158732328 |
| Molecular Formula | C21H25ClN6O3 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | tert-butyl 3-[[(5-chloro-1H-indole-2-carbonyl)amino]methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCn2nnc(CNC(=O)c3cc4cc(Cl)ccc4[nH]3)c2C1 |
| InChI | InChI=1S/C21H25ClN6O3/c1-21(2,3)31-20(30)27-7-4-8-28-18(12-27)17(25-26-28)11-23-19(29)16-10-13-9-14(22)5-6-15(13)24-16/h5-6,9-10,24H,4,7-8,11-12H2,1-3H3,(H,23,29) |
| InChIKey | ILGBDYXPRIBJOV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |