C14H16ClN3O — CID 18442871
N-[(1R,2R)-2-aminocyclopentyl]-5-chloro-1H-indole-2-carboxamide (PubChem CID 18442871) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclopentyl]-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-aminocyclopentyl]-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 18442871 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclopentyl]-5-chloro-1H-indole-2-carboxamide |
| SMILES | N[C@@H]1CCC[C@H]1NC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C14H16ClN3O/c15-9-4-5-11-8(6-9)7-13(17-11)14(19)18-12-3-1-2-10(12)16/h4-7,10,12,17H,1-3,16H2,(H,18,19)/t10-,12-/m1/s1 |
| InChIKey | BTBGEXWJGQIWAQ-ZYHUDNBSSA-N |
| XLogP | 2.43 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |