C27H25ClN4O3 — CID 67188500
5-chloro-N-[2-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 67188500) has the molecular formula C27H25ClN4O3 and a molecular weight of 488.98 g/mol. Its IUPAC name is 5-chloro-N-[2-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67188500 |
| Molecular Formula | C27H25ClN4O3 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 5-chloro-N-[2-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCCCC1NC(=O)c1cc2cc(Cl)ccc2[nH]1)c1ccc(-c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C27H25ClN4O3/c28-21-9-10-22-20(15-21)16-25(29-22)27(34)31-24-4-2-1-3-23(24)30-26(33)19-7-5-17(6-8-19)18-11-13-32(35)14-12-18/h5-16,23-24,29H,1-4H2,(H,30,33)(H,31,34) |
| InChIKey | IEADWKJOPJZEPP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|