C27H29ClN4O3 — CID 11488766
5-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 11488766) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 5-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11488766 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCCCC1NC(=O)c1cc2cc(Cl)ccc2[nH]1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C27H29ClN4O3/c28-19-10-13-21-18(15-19)16-24(29-21)27(35)31-23-6-2-1-5-22(23)30-26(34)17-8-11-20(12-9-17)32-14-4-3-7-25(32)33/h8-13,15-16,22-23,29H,1-7,14H2,(H,30,34)(H,31,35) |
| InChIKey | KGOJAQYSHZWPMB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |