C25H25ClN4O3S — CID 22240412
6-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclopentyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 22240412) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is 6-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclopentyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclopentyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22240412 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 6-chloro-N-[2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]cyclopentyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCCC1NC(=O)c1cc2ccc(Cl)nc2s1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C25H25ClN4O3S/c26-21-12-9-16-14-20(34-25(16)29-21)24(33)28-19-5-3-4-18(19)27-23(32)15-7-10-17(11-8-15)30-13-2-1-6-22(30)31/h7-12,14,18-19H,1-6,13H2,(H,27,32)(H,28,33) |
| InChIKey | ARQMSZRJRCWDAG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|