C11H14N2O4S — CID 114040333
N-[(1,1-dioxothiolan-3-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 114040333) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114040333 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C11H14N2O4S/c14-10-3-1-2-9(13-10)11(15)12-6-8-4-5-18(16,17)7-8/h1-3,8H,4-7H2,(H,12,15)(H,13,14) |
| InChIKey | GAOKLQNPINUIOO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |