C11H14N2O3S — CID 47156864
N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-carboxamide (PubChem CID 47156864) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47156864 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)c1cccnc1 |
| InChI | InChI=1S/C11H14N2O3S/c14-11(10-2-1-4-12-7-10)13-6-9-3-5-17(15,16)8-9/h1-2,4,7,9H,3,5-6,8H2,(H,13,14) |
| InChIKey | RXLLYYZSZVGTEY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |