C14H16N4O3S — CID 94006565
N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 94006565) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 94006565 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NC[C@@H]1CCS(=O)(=O)C1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C14H16N4O3S/c19-14(16-7-11-5-6-22(20,21)8-11)12-1-3-13(4-2-12)18-10-15-9-17-18/h1-4,9-11H,5-8H2,(H,16,19)/t11-/m0/s1 |
| InChIKey | QFEBBGNAYOJDDI-NSHDSACASA-N |
| XLogP | 0.43 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |